C22H27N5O6 — CID 156593212
N-(2,5-dimethoxyphenyl)-2-[3-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydroquinazolin-1-yl]acetamide (PubChem CID 156593212) has the molecular formula C22H27N5O6 and a molecular weight of 457.49 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-2-[3-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydroquinazolin-1-yl]acetamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-2-[3-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydroquinazolin-1-yl]acetamide |
|---|---|
| PubChem CID | 156593212 |
| Molecular Formula | C22H27N5O6 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-2-[3-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydroquinazolin-1-yl]acetamide |
| SMILES | COc1ccc(OC)c(NC(=O)CN2C(=O)N(Cc3nc(C)no3)C(=O)C3CCCCC32)c1 |
| InChI | InChI=1S/C22H27N5O6/c1-13-23-20(33-25-13)12-27-21(29)15-6-4-5-7-17(15)26(22(27)30)11-19(28)24-16-10-14(31-2)8-9-18(16)32-3/h8-10,15,17H,4-7,11-12H2,1-3H3,(H,24,28) |
| InChIKey | WIWQZQHWCAOWPR-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 127.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |