C25H26Cl2N4O4 — CID 156589664
2-[3-[2-[(2,4-dichlorophenyl)methylamino]-2-oxoethyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydroquinazolin-1-yl]-N-phenylacetamide (PubChem CID 156589664) has the molecular formula C25H26Cl2N4O4 and a molecular weight of 517.41 g/mol. Its IUPAC name is 2-[3-[2-[(2,4-dichlorophenyl)methylamino]-2-oxoethyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydroquinazolin-1-yl]-N-phenylacetamide.
| Compound Name | 2-[3-[2-[(2,4-dichlorophenyl)methylamino]-2-oxoethyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydroquinazolin-1-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 156589664 |
| Molecular Formula | C25H26Cl2N4O4 |
| Molecular Weight | 517.41 g/mol |
| Exact Mass | 516.13 |
| IUPAC Name | 2-[3-[2-[(2,4-dichlorophenyl)methylamino]-2-oxoethyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydroquinazolin-1-yl]-N-phenylacetamide |
| SMILES | O=C(CN1C(=O)C2CCCCC2N(CC(=O)Nc2ccccc2)C1=O)NCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C25H26Cl2N4O4/c26-17-11-10-16(20(27)12-17)13-28-22(32)14-31-24(34)19-8-4-5-9-21(19)30(25(31)35)15-23(33)29-18-6-2-1-3-7-18/h1-3,6-7,10-12,19,21H,4-5,8-9,13-15H2,(H,28,32)(H,29,33) |
| InChIKey | AJBXXKYBFBRSSC-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.41 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |