C24H24N2O4 — CID 73265092
1,3-diphenacyl-4a,5,6,7,8,8a-hexahydroquinazoline-2,4-dione (PubChem CID 73265092) has the molecular formula C24H24N2O4 and a molecular weight of 404.47 g/mol. Its IUPAC name is 1,3-diphenacyl-4a,5,6,7,8,8a-hexahydroquinazoline-2,4-dione.
| Compound Name | 1,3-diphenacyl-4a,5,6,7,8,8a-hexahydroquinazoline-2,4-dione |
|---|---|
| PubChem CID | 73265092 |
| Molecular Formula | C24H24N2O4 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 1,3-diphenacyl-4a,5,6,7,8,8a-hexahydroquinazoline-2,4-dione |
| SMILES | O=C(CN1C(=O)C2CCCCC2N(CC(=O)c2ccccc2)C1=O)c1ccccc1 |
| InChI | InChI=1S/C24H24N2O4/c27-21(17-9-3-1-4-10-17)15-25-20-14-8-7-13-19(20)23(29)26(24(25)30)16-22(28)18-11-5-2-6-12-18/h1-6,9-12,19-20H,7-8,13-16H2 |
| InChIKey | FTQJCFSKHKTCJS-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |