C25H36N4O4 — CID 74536338
5-[1-[2-(3-methylanilino)-2-oxoethyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydroquinazolin-3-yl]-N-propylpentanamide (PubChem CID 74536338) has the molecular formula C25H36N4O4 and a molecular weight of 456.59 g/mol. Its IUPAC name is 5-[1-[2-(3-methylanilino)-2-oxoethyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydroquinazolin-3-yl]-N-propylpentanamide.
| Compound Name | 5-[1-[2-(3-methylanilino)-2-oxoethyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydroquinazolin-3-yl]-N-propylpentanamide |
|---|---|
| PubChem CID | 74536338 |
| Molecular Formula | C25H36N4O4 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.27 |
| IUPAC Name | 5-[1-[2-(3-methylanilino)-2-oxoethyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydroquinazolin-3-yl]-N-propylpentanamide |
| SMILES | CCCNC(=O)CCCCN1C(=O)C2CCCCC2N(CC(=O)Nc2cccc(C)c2)C1=O |
| InChI | InChI=1S/C25H36N4O4/c1-3-14-26-22(30)13-6-7-15-28-24(32)20-11-4-5-12-21(20)29(25(28)33)17-23(31)27-19-10-8-9-18(2)16-19/h8-10,16,20-21H,3-7,11-15,17H2,1-2H3,(H,26,30)(H,27,31) |
| InChIKey | HKQBFBJIAKHBNZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|