C29H34N4O7 — CID 75185759
N-(1,3-benzodioxol-5-ylmethyl)-3-[1-[2-(4-ethoxyanilino)-2-oxoethyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydroquinazolin-3-yl]propanamide (PubChem CID 75185759) has the molecular formula C29H34N4O7 and a molecular weight of 550.61 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-3-[1-[2-(4-ethoxyanilino)-2-oxoethyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydroquinazolin-3-yl]propanamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-3-[1-[2-(4-ethoxyanilino)-2-oxoethyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydroquinazolin-3-yl]propanamide |
|---|---|
| PubChem CID | 75185759 |
| Molecular Formula | C29H34N4O7 |
| Molecular Weight | 550.61 g/mol |
| Exact Mass | 550.24 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-3-[1-[2-(4-ethoxyanilino)-2-oxoethyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydroquinazolin-3-yl]propanamide |
| SMILES | CCOc1ccc(NC(=O)CN2C(=O)N(CCC(=O)NCc3ccc4c(c3)OCO4)C(=O)C3CCCCC32)cc1 |
| InChI | InChI=1S/C29H34N4O7/c1-2-38-21-10-8-20(9-11-21)31-27(35)17-33-23-6-4-3-5-22(23)28(36)32(29(33)37)14-13-26(34)30-16-19-7-12-24-25(15-19)40-18-39-24/h7-12,15,22-23H,2-6,13-14,16-18H2,1H3,(H,30,34)(H,31,35) |
| InChIKey | FQOCGTRDVSSRFA-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 126.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.61 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |