C30H28N4O7 — CID 46254565
N-(1,3-benzodioxol-5-ylmethyl)-1-[2-(4-ethoxyanilino)-2-oxoethyl]-2,4-dioxo-3-prop-2-enylquinazoline-7-carboxamide (PubChem CID 46254565) has the molecular formula C30H28N4O7 and a molecular weight of 556.58 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-1-[2-(4-ethoxyanilino)-2-oxoethyl]-2,4-dioxo-3-prop-2-enylquinazoline-7-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-1-[2-(4-ethoxyanilino)-2-oxoethyl]-2,4-dioxo-3-prop-2-enylquinazoline-7-carboxamide |
|---|---|
| PubChem CID | 46254565 |
| Molecular Formula | C30H28N4O7 |
| Molecular Weight | 556.58 g/mol |
| Exact Mass | 556.20 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-1-[2-(4-ethoxyanilino)-2-oxoethyl]-2,4-dioxo-3-prop-2-enylquinazoline-7-carboxamide |
| SMILES | C=CCn1c(=O)c2ccc(C(=O)NCc3ccc4c(c3)OCO4)cc2n(CC(=O)Nc2ccc(OCC)cc2)c1=O |
| InChI | InChI=1S/C30H28N4O7/c1-3-13-33-29(37)23-11-6-20(28(36)31-16-19-5-12-25-26(14-19)41-18-40-25)15-24(23)34(30(33)38)17-27(35)32-21-7-9-22(10-8-21)39-4-2/h3,5-12,14-15H,1,4,13,16-18H2,2H3,(H,31,36)(H,32,35) |
| InChIKey | FILVABBFAIRGIM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 129.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.58 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|