C29H32N4O6 — CID 59541359
N-(1,3-benzodioxol-5-ylmethyl)-3-but-3-enyl-1-[2-(cyclohexylamino)-2-oxoethyl]-2,4-dioxoquinazoline-7-carboxamide (PubChem CID 59541359) has the molecular formula C29H32N4O6 and a molecular weight of 532.60 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-3-but-3-enyl-1-[2-(cyclohexylamino)-2-oxoethyl]-2,4-dioxoquinazoline-7-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-3-but-3-enyl-1-[2-(cyclohexylamino)-2-oxoethyl]-2,4-dioxoquinazoline-7-carboxamide |
|---|---|
| PubChem CID | 59541359 |
| Molecular Formula | C29H32N4O6 |
| Molecular Weight | 532.60 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-3-but-3-enyl-1-[2-(cyclohexylamino)-2-oxoethyl]-2,4-dioxoquinazoline-7-carboxamide |
| SMILES | C=CCCn1c(=O)c2ccc(C(=O)NCc3ccc4c(c3)OCO4)cc2n(CC(=O)NC2CCCCC2)c1=O |
| InChI | InChI=1S/C29H32N4O6/c1-2-3-13-32-28(36)22-11-10-20(27(35)30-16-19-9-12-24-25(14-19)39-18-38-24)15-23(22)33(29(32)37)17-26(34)31-21-7-5-4-6-8-21/h2,9-12,14-15,21H,1,3-8,13,16-18H2,(H,30,35)(H,31,34) |
| InChIKey | AYQXEJVUOUOPCG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 120.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.60 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|