C25H26N4O7 — CID 74754451
N-(1,3-benzodioxol-5-ylmethyl)-2-[3-(1,3-benzodioxol-5-ylmethyl)-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrido[3,2-d]pyrimidin-1-yl]acetamide (PubChem CID 74754451) has the molecular formula C25H26N4O7 and a molecular weight of 494.50 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-[3-(1,3-benzodioxol-5-ylmethyl)-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrido[3,2-d]pyrimidin-1-yl]acetamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[3-(1,3-benzodioxol-5-ylmethyl)-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrido[3,2-d]pyrimidin-1-yl]acetamide |
|---|---|
| PubChem CID | 74754451 |
| Molecular Formula | C25H26N4O7 |
| Molecular Weight | 494.50 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[3-(1,3-benzodioxol-5-ylmethyl)-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrido[3,2-d]pyrimidin-1-yl]acetamide |
| SMILES | O=C(CN1C(=O)N(Cc2ccc3c(c2)OCO3)C(=O)C2NCCCC21)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C25H26N4O7/c30-22(27-10-15-3-5-18-20(8-15)35-13-33-18)12-28-17-2-1-7-26-23(17)24(31)29(25(28)32)11-16-4-6-19-21(9-16)36-14-34-19/h3-6,8-9,17,23,26H,1-2,7,10-14H2,(H,27,30) |
| InChIKey | QSNUFRCZNQILJM-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 118.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.50 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |