C26H26FN3O6 — CID 73221087
2-[3-(1,3-benzodioxol-5-ylmethyl)-2,4-dioxo-4a,5a,6,7,8,9,9a,9b-octahydro-[1]benzofuro[3,2-d]pyrimidin-1-yl]-N-(4-fluorophenyl)acetamide (PubChem CID 73221087) has the molecular formula C26H26FN3O6 and a molecular weight of 495.51 g/mol. Its IUPAC name is 2-[3-(1,3-benzodioxol-5-ylmethyl)-2,4-dioxo-4a,5a,6,7,8,9,9a,9b-octahydro-[1]benzofuro[3,2-d]pyrimidin-1-yl]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[3-(1,3-benzodioxol-5-ylmethyl)-2,4-dioxo-4a,5a,6,7,8,9,9a,9b-octahydro-[1]benzofuro[3,2-d]pyrimidin-1-yl]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 73221087 |
| Molecular Formula | C26H26FN3O6 |
| Molecular Weight | 495.51 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | 2-[3-(1,3-benzodioxol-5-ylmethyl)-2,4-dioxo-4a,5a,6,7,8,9,9a,9b-octahydro-[1]benzofuro[3,2-d]pyrimidin-1-yl]-N-(4-fluorophenyl)acetamide |
| SMILES | O=C(CN1C(=O)N(Cc2ccc3c(c2)OCO3)C(=O)C2OC3CCCCC3C21)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C26H26FN3O6/c27-16-6-8-17(9-7-16)28-22(31)13-29-23-18-3-1-2-4-19(18)36-24(23)25(32)30(26(29)33)12-15-5-10-20-21(11-15)35-14-34-20/h5-11,18-19,23-24H,1-4,12-14H2,(H,28,31) |
| InChIKey | VNPLLPUVEGPQJL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.51 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |