C24H26N4O5 — CID 74535414
2-[3-(1,3-benzodioxol-5-ylmethyl)-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrido[3,2-d]pyrimidin-1-yl]-N-benzylacetamide (PubChem CID 74535414) has the molecular formula C24H26N4O5 and a molecular weight of 450.50 g/mol. Its IUPAC name is 2-[3-(1,3-benzodioxol-5-ylmethyl)-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrido[3,2-d]pyrimidin-1-yl]-N-benzylacetamide.
| Compound Name | 2-[3-(1,3-benzodioxol-5-ylmethyl)-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrido[3,2-d]pyrimidin-1-yl]-N-benzylacetamide |
|---|---|
| PubChem CID | 74535414 |
| Molecular Formula | C24H26N4O5 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | 2-[3-(1,3-benzodioxol-5-ylmethyl)-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrido[3,2-d]pyrimidin-1-yl]-N-benzylacetamide |
| SMILES | O=C(CN1C(=O)N(Cc2ccc3c(c2)OCO3)C(=O)C2NCCCC21)NCc1ccccc1 |
| InChI | InChI=1S/C24H26N4O5/c29-21(26-12-16-5-2-1-3-6-16)14-27-18-7-4-10-25-22(18)23(30)28(24(27)31)13-17-8-9-19-20(11-17)33-15-32-19/h1-3,5-6,8-9,11,18,22,25H,4,7,10,12-15H2,(H,26,29) |
| InChIKey | RBTOOHJRMUAMMD-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |