C25H22N2O4 — CID 142653839
(5S)-1-(1,3-benzodioxol-5-ylmethyl)-3,5-dibenzylimidazolidine-2,4-dione (PubChem CID 142653839) has the molecular formula C25H22N2O4 and a molecular weight of 414.46 g/mol. Its IUPAC name is (5S)-1-(1,3-benzodioxol-5-ylmethyl)-3,5-dibenzylimidazolidine-2,4-dione.
| Compound Name | (5S)-1-(1,3-benzodioxol-5-ylmethyl)-3,5-dibenzylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 142653839 |
| Molecular Formula | C25H22N2O4 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | (5S)-1-(1,3-benzodioxol-5-ylmethyl)-3,5-dibenzylimidazolidine-2,4-dione |
| SMILES | O=C1[C@H](Cc2ccccc2)N(Cc2ccc3c(c2)OCO3)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C25H22N2O4/c28-24-21(13-18-7-3-1-4-8-18)26(16-20-11-12-22-23(14-20)31-17-30-22)25(29)27(24)15-19-9-5-2-6-10-19/h1-12,14,21H,13,15-17H2/t21-/m0/s1 |
| InChIKey | PUEZUARUMDTKML-NRFANRHFSA-N |
| XLogP | 3.99 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|