C30H38N4O5 — CID 156591345
4-[1-[2-(4-ethylanilino)-2-oxoethyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydroquinazolin-3-yl]-N-[(2-methoxyphenyl)methyl]butanamide (PubChem CID 156591345) has the molecular formula C30H38N4O5 and a molecular weight of 534.66 g/mol. Its IUPAC name is 4-[1-[2-(4-ethylanilino)-2-oxoethyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydroquinazolin-3-yl]-N-[(2-methoxyphenyl)methyl]butanamide.
| Compound Name | 4-[1-[2-(4-ethylanilino)-2-oxoethyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydroquinazolin-3-yl]-N-[(2-methoxyphenyl)methyl]butanamide |
|---|---|
| PubChem CID | 156591345 |
| Molecular Formula | C30H38N4O5 |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.28 |
| IUPAC Name | 4-[1-[2-(4-ethylanilino)-2-oxoethyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydroquinazolin-3-yl]-N-[(2-methoxyphenyl)methyl]butanamide |
| SMILES | CCc1ccc(NC(=O)CN2C(=O)N(CCCC(=O)NCc3ccccc3OC)C(=O)C3CCCCC32)cc1 |
| InChI | InChI=1S/C30H38N4O5/c1-3-21-14-16-23(17-15-21)32-28(36)20-34-25-11-6-5-10-24(25)29(37)33(30(34)38)18-8-13-27(35)31-19-22-9-4-7-12-26(22)39-2/h4,7,9,12,14-17,24-25H,3,5-6,8,10-11,13,18-20H2,1-2H3,(H,31,35)(H,32,36) |
| InChIKey | PDZXEKOJKXLJGG-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |