C24H28ClN5O5 — CID 156593254
N-(4-chloro-2-methoxy-5-methylphenyl)-2-[3-[(3-methoxyphenyl)methyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydropteridin-1-yl]acetamide (PubChem CID 156593254) has the molecular formula C24H28ClN5O5 and a molecular weight of 501.97 g/mol. Its IUPAC name is N-(4-chloro-2-methoxy-5-methylphenyl)-2-[3-[(3-methoxyphenyl)methyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydropteridin-1-yl]acetamide.
| Compound Name | N-(4-chloro-2-methoxy-5-methylphenyl)-2-[3-[(3-methoxyphenyl)methyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydropteridin-1-yl]acetamide |
|---|---|
| PubChem CID | 156593254 |
| Molecular Formula | C24H28ClN5O5 |
| Molecular Weight | 501.97 g/mol |
| Exact Mass | 501.18 |
| IUPAC Name | N-(4-chloro-2-methoxy-5-methylphenyl)-2-[3-[(3-methoxyphenyl)methyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydropteridin-1-yl]acetamide |
| SMILES | COc1cccc(CN2C(=O)C3NCCNC3N(CC(=O)Nc3cc(C)c(Cl)cc3OC)C2=O)c1 |
| InChI | InChI=1S/C24H28ClN5O5/c1-14-9-18(19(35-3)11-17(14)25)28-20(31)13-29-22-21(26-7-8-27-22)23(32)30(24(29)33)12-15-5-4-6-16(10-15)34-2/h4-6,9-11,21-22,26-27H,7-8,12-13H2,1-3H3,(H,28,31) |
| InChIKey | XQBRXHSMCMCLII-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.97 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |