C23H26FN5O4 — CID 156593222
2-[3-[(4-fluorophenyl)methyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydropteridin-1-yl]-N-(2-methoxy-5-methylphenyl)acetamide (PubChem CID 156593222) has the molecular formula C23H26FN5O4 and a molecular weight of 455.49 g/mol. Its IUPAC name is 2-[3-[(4-fluorophenyl)methyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydropteridin-1-yl]-N-(2-methoxy-5-methylphenyl)acetamide.
| Compound Name | 2-[3-[(4-fluorophenyl)methyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydropteridin-1-yl]-N-(2-methoxy-5-methylphenyl)acetamide |
|---|---|
| PubChem CID | 156593222 |
| Molecular Formula | C23H26FN5O4 |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | 2-[3-[(4-fluorophenyl)methyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydropteridin-1-yl]-N-(2-methoxy-5-methylphenyl)acetamide |
| SMILES | COc1ccc(C)cc1NC(=O)CN1C(=O)N(Cc2ccc(F)cc2)C(=O)C2NCCNC21 |
| InChI | InChI=1S/C23H26FN5O4/c1-14-3-8-18(33-2)17(11-14)27-19(30)13-28-21-20(25-9-10-26-21)22(31)29(23(28)32)12-15-4-6-16(24)7-5-15/h3-8,11,20-21,25-26H,9-10,12-13H2,1-2H3,(H,27,30) |
| InChIKey | YTDMNUICQWPBRF-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |