C23H24Cl2N2O4 — CID 73374212
3-(3-chlorophenyl)-1-[(4-chlorophenyl)methyl]-6,7-dimethoxy-4a,5,6,7,8,8a-hexahydroquinazoline-2,4-dione (PubChem CID 73374212) has the molecular formula C23H24Cl2N2O4 and a molecular weight of 463.36 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1-[(4-chlorophenyl)methyl]-6,7-dimethoxy-4a,5,6,7,8,8a-hexahydroquinazoline-2,4-dione.
| Compound Name | 3-(3-chlorophenyl)-1-[(4-chlorophenyl)methyl]-6,7-dimethoxy-4a,5,6,7,8,8a-hexahydroquinazoline-2,4-dione |
|---|---|
| PubChem CID | 73374212 |
| Molecular Formula | C23H24Cl2N2O4 |
| Molecular Weight | 463.36 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | 3-(3-chlorophenyl)-1-[(4-chlorophenyl)methyl]-6,7-dimethoxy-4a,5,6,7,8,8a-hexahydroquinazoline-2,4-dione |
| SMILES | COC1CC2C(=O)N(c3cccc(Cl)c3)C(=O)N(Cc3ccc(Cl)cc3)C2CC1OC |
| InChI | InChI=1S/C23H24Cl2N2O4/c1-30-20-11-18-19(12-21(20)31-2)26(13-14-6-8-15(24)9-7-14)23(29)27(22(18)28)17-5-3-4-16(25)10-17/h3-10,18-21H,11-13H2,1-2H3 |
| InChIKey | UXFPUCXUUHLOES-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.36 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |