C24H26ClN3O5 — CID 73373238
N-(3-chlorophenyl)-2-(6,7-dimethoxy-2,4-dioxo-3-phenyl-4a,5,6,7,8,8a-hexahydroquinazolin-1-yl)acetamide (PubChem CID 73373238) has the molecular formula C24H26ClN3O5 and a molecular weight of 471.94 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-(6,7-dimethoxy-2,4-dioxo-3-phenyl-4a,5,6,7,8,8a-hexahydroquinazolin-1-yl)acetamide.
| Compound Name | N-(3-chlorophenyl)-2-(6,7-dimethoxy-2,4-dioxo-3-phenyl-4a,5,6,7,8,8a-hexahydroquinazolin-1-yl)acetamide |
|---|---|
| PubChem CID | 73373238 |
| Molecular Formula | C24H26ClN3O5 |
| Molecular Weight | 471.94 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | N-(3-chlorophenyl)-2-(6,7-dimethoxy-2,4-dioxo-3-phenyl-4a,5,6,7,8,8a-hexahydroquinazolin-1-yl)acetamide |
| SMILES | COC1CC2C(=O)N(c3ccccc3)C(=O)N(CC(=O)Nc3cccc(Cl)c3)C2CC1OC |
| InChI | InChI=1S/C24H26ClN3O5/c1-32-20-12-18-19(13-21(20)33-2)27(14-22(29)26-16-8-6-7-15(25)11-16)24(31)28(23(18)30)17-9-4-3-5-10-17/h3-11,18-21H,12-14H2,1-2H3,(H,26,29) |
| InChIKey | UNBWLAIHXHEPAC-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.94 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |