C22H18ClN3O3S — CID 19584942
2-[1-(3-chlorophenyl)-2,5-dioxo-3-(thiophen-2-ylmethyl)imidazolidin-4-yl]-N-phenylacetamide (PubChem CID 19584942) has the molecular formula C22H18ClN3O3S and a molecular weight of 439.92 g/mol. Its IUPAC name is 2-[1-(3-chlorophenyl)-2,5-dioxo-3-(thiophen-2-ylmethyl)imidazolidin-4-yl]-N-phenylacetamide.
| Compound Name | 2-[1-(3-chlorophenyl)-2,5-dioxo-3-(thiophen-2-ylmethyl)imidazolidin-4-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 19584942 |
| Molecular Formula | C22H18ClN3O3S |
| Molecular Weight | 439.92 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | 2-[1-(3-chlorophenyl)-2,5-dioxo-3-(thiophen-2-ylmethyl)imidazolidin-4-yl]-N-phenylacetamide |
| SMILES | O=C(CC1C(=O)N(c2cccc(Cl)c2)C(=O)N1Cc1cccs1)Nc1ccccc1 |
| InChI | InChI=1S/C22H18ClN3O3S/c23-15-6-4-9-17(12-15)26-21(28)19(13-20(27)24-16-7-2-1-3-8-16)25(22(26)29)14-18-10-5-11-30-18/h1-12,19H,13-14H2,(H,24,27) |
| InChIKey | WBUPHPHUVHJRTQ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.92 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|