C25H21Cl2N3O2S — CID 3457715
2-[1-(3-chlorophenyl)-3-[2-(4-chlorophenyl)ethyl]-5-oxo-2-sulfanylideneimidazolidin-4-yl]-N-phenylacetamide (PubChem CID 3457715) has the molecular formula C25H21Cl2N3O2S and a molecular weight of 498.44 g/mol. Its IUPAC name is 2-[1-(3-chlorophenyl)-3-[2-(4-chlorophenyl)ethyl]-5-oxo-2-sulfanylideneimidazolidin-4-yl]-N-phenylacetamide.
| Compound Name | 2-[1-(3-chlorophenyl)-3-[2-(4-chlorophenyl)ethyl]-5-oxo-2-sulfanylideneimidazolidin-4-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 3457715 |
| Molecular Formula | C25H21Cl2N3O2S |
| Molecular Weight | 498.44 g/mol |
| Exact Mass | 497.07 |
| IUPAC Name | 2-[1-(3-chlorophenyl)-3-[2-(4-chlorophenyl)ethyl]-5-oxo-2-sulfanylideneimidazolidin-4-yl]-N-phenylacetamide |
| SMILES | O=C(CC1C(=O)N(c2cccc(Cl)c2)C(=S)N1CCc1ccc(Cl)cc1)Nc1ccccc1 |
| InChI | InChI=1S/C25H21Cl2N3O2S/c26-18-11-9-17(10-12-18)13-14-29-22(16-23(31)28-20-6-2-1-3-7-20)24(32)30(25(29)33)21-8-4-5-19(27)15-21/h1-12,15,22H,13-14,16H2,(H,28,31) |
| InChIKey | XVZVNHOVJWGHFF-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.44 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|