C23H20FN3O4S — CID 41284920
N-(3-fluorophenyl)-2-[(4R)-1-(3-methoxyphenyl)-2,5-dioxo-3-(thiophen-2-ylmethyl)imidazolidin-4-yl]acetamide (PubChem CID 41284920) has the molecular formula C23H20FN3O4S and a molecular weight of 453.50 g/mol. Its IUPAC name is N-(3-fluorophenyl)-2-[(4R)-1-(3-methoxyphenyl)-2,5-dioxo-3-(thiophen-2-ylmethyl)imidazolidin-4-yl]acetamide.
| Compound Name | N-(3-fluorophenyl)-2-[(4R)-1-(3-methoxyphenyl)-2,5-dioxo-3-(thiophen-2-ylmethyl)imidazolidin-4-yl]acetamide |
|---|---|
| PubChem CID | 41284920 |
| Molecular Formula | C23H20FN3O4S |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | N-(3-fluorophenyl)-2-[(4R)-1-(3-methoxyphenyl)-2,5-dioxo-3-(thiophen-2-ylmethyl)imidazolidin-4-yl]acetamide |
| SMILES | COc1cccc(N2C(=O)[C@@H](CC(=O)Nc3cccc(F)c3)N(Cc3cccs3)C2=O)c1 |
| InChI | InChI=1S/C23H20FN3O4S/c1-31-18-8-3-7-17(12-18)27-22(29)20(26(23(27)30)14-19-9-4-10-32-19)13-21(28)25-16-6-2-5-15(24)11-16/h2-12,20H,13-14H2,1H3,(H,25,28)/t20-/m1/s1 |
| InChIKey | INNLIMYTRUXGDT-HXUWFJFHSA-N |
| XLogP | 4.26 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|