C18H17ClN2O3S — CID 4164982
3-(3-chlorophenyl)-1-[(3,4-dimethoxyphenyl)methyl]-2-sulfanylideneimidazolidin-4-one (PubChem CID 4164982) has the molecular formula C18H17ClN2O3S and a molecular weight of 376.87 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1-[(3,4-dimethoxyphenyl)methyl]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | 3-(3-chlorophenyl)-1-[(3,4-dimethoxyphenyl)methyl]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 4164982 |
| Molecular Formula | C18H17ClN2O3S |
| Molecular Weight | 376.87 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | 3-(3-chlorophenyl)-1-[(3,4-dimethoxyphenyl)methyl]-2-sulfanylideneimidazolidin-4-one |
| SMILES | COc1ccc(CN2CC(=O)N(c3cccc(Cl)c3)C2=S)cc1OC |
| InChI | InChI=1S/C18H17ClN2O3S/c1-23-15-7-6-12(8-16(15)24-2)10-20-11-17(22)21(18(20)25)14-5-3-4-13(19)9-14/h3-9H,10-11H2,1-2H3 |
| InChIKey | GBIDPAKKHUGIII-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.87 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|