C22H23BrN2O2 — CID 73371635
6-bromo-1-[(4-methylphenyl)methyl]-3-phenyl-4a,5,6,7,8,8a-hexahydroquinazoline-2,4-dione (PubChem CID 73371635) has the molecular formula C22H23BrN2O2 and a molecular weight of 427.34 g/mol. Its IUPAC name is 6-bromo-1-[(4-methylphenyl)methyl]-3-phenyl-4a,5,6,7,8,8a-hexahydroquinazoline-2,4-dione.
| Compound Name | 6-bromo-1-[(4-methylphenyl)methyl]-3-phenyl-4a,5,6,7,8,8a-hexahydroquinazoline-2,4-dione |
|---|---|
| PubChem CID | 73371635 |
| Molecular Formula | C22H23BrN2O2 |
| Molecular Weight | 427.34 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | 6-bromo-1-[(4-methylphenyl)methyl]-3-phenyl-4a,5,6,7,8,8a-hexahydroquinazoline-2,4-dione |
| SMILES | Cc1ccc(CN2C(=O)N(c3ccccc3)C(=O)C3CC(Br)CCC32)cc1 |
| InChI | InChI=1S/C22H23BrN2O2/c1-15-7-9-16(10-8-15)14-24-20-12-11-17(23)13-19(20)21(26)25(22(24)27)18-5-3-2-4-6-18/h2-10,17,19-20H,11-14H2,1H3 |
| InChIKey | ZIHMLEIAPGEJDF-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.34 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|