C23H22BrClN2O4 — CID 73374194
6-bromo-3-(4-chlorophenyl)-1-[2-(4-methoxyphenyl)-2-oxoethyl]-4a,5,6,7,8,8a-hexahydroquinazoline-2,4-dione (PubChem CID 73374194) has the molecular formula C23H22BrClN2O4 and a molecular weight of 505.80 g/mol. Its IUPAC name is 6-bromo-3-(4-chlorophenyl)-1-[2-(4-methoxyphenyl)-2-oxoethyl]-4a,5,6,7,8,8a-hexahydroquinazoline-2,4-dione.
| Compound Name | 6-bromo-3-(4-chlorophenyl)-1-[2-(4-methoxyphenyl)-2-oxoethyl]-4a,5,6,7,8,8a-hexahydroquinazoline-2,4-dione |
|---|---|
| PubChem CID | 73374194 |
| Molecular Formula | C23H22BrClN2O4 |
| Molecular Weight | 505.80 g/mol |
| Exact Mass | 504.05 |
| IUPAC Name | 6-bromo-3-(4-chlorophenyl)-1-[2-(4-methoxyphenyl)-2-oxoethyl]-4a,5,6,7,8,8a-hexahydroquinazoline-2,4-dione |
| SMILES | COc1ccc(C(=O)CN2C(=O)N(c3ccc(Cl)cc3)C(=O)C3CC(Br)CCC32)cc1 |
| InChI | InChI=1S/C23H22BrClN2O4/c1-31-18-9-2-14(3-10-18)21(28)13-26-20-11-4-15(24)12-19(20)22(29)27(23(26)30)17-7-5-16(25)6-8-17/h2-3,5-10,15,19-20H,4,11-13H2,1H3 |
| InChIKey | SPWMAJAIMWBGRX-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.80 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|