C21H20BrClN2O2 — CID 73371632
6-bromo-1-[(2-chlorophenyl)methyl]-3-phenyl-4a,5,6,7,8,8a-hexahydroquinazoline-2,4-dione (PubChem CID 73371632) has the molecular formula C21H20BrClN2O2 and a molecular weight of 447.76 g/mol. Its IUPAC name is 6-bromo-1-[(2-chlorophenyl)methyl]-3-phenyl-4a,5,6,7,8,8a-hexahydroquinazoline-2,4-dione.
| Compound Name | 6-bromo-1-[(2-chlorophenyl)methyl]-3-phenyl-4a,5,6,7,8,8a-hexahydroquinazoline-2,4-dione |
|---|---|
| PubChem CID | 73371632 |
| Molecular Formula | C21H20BrClN2O2 |
| Molecular Weight | 447.76 g/mol |
| Exact Mass | 446.04 |
| IUPAC Name | 6-bromo-1-[(2-chlorophenyl)methyl]-3-phenyl-4a,5,6,7,8,8a-hexahydroquinazoline-2,4-dione |
| SMILES | O=C1C2CC(Br)CCC2N(Cc2ccccc2Cl)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C21H20BrClN2O2/c22-15-10-11-19-17(12-15)20(26)25(16-7-2-1-3-8-16)21(27)24(19)13-14-6-4-5-9-18(14)23/h1-9,15,17,19H,10-13H2 |
| InChIKey | FQGHVLJVLXVWHA-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.76 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|