C13H15ClN2O2 — CID 64874852
1-[(2-chlorophenyl)methyl]-3,6-dimethylpiperazine-2,5-dione (PubChem CID 64874852) has the molecular formula C13H15ClN2O2 and a molecular weight of 266.73 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-3,6-dimethylpiperazine-2,5-dione.
| Compound Name | 1-[(2-chlorophenyl)methyl]-3,6-dimethylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 64874852 |
| Molecular Formula | C13H15ClN2O2 |
| Molecular Weight | 266.73 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-3,6-dimethylpiperazine-2,5-dione |
| SMILES | CC1NC(=O)C(C)N(Cc2ccccc2Cl)C1=O |
| InChI | InChI=1S/C13H15ClN2O2/c1-8-13(18)16(9(2)12(17)15-8)7-10-5-3-4-6-11(10)14/h3-6,8-9H,7H2,1-2H3,(H,15,17) |
| InChIKey | OOPDLBDZCYKSQQ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.73 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |