C29H34ClN3O3 — CID 75545038
2-[4-[1-[(2-chlorophenyl)methyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydroquinazolin-3-yl]phenyl]-N-cyclohexylacetamide (PubChem CID 75545038) has the molecular formula C29H34ClN3O3 and a molecular weight of 508.06 g/mol. Its IUPAC name is 2-[4-[1-[(2-chlorophenyl)methyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydroquinazolin-3-yl]phenyl]-N-cyclohexylacetamide.
| Compound Name | 2-[4-[1-[(2-chlorophenyl)methyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydroquinazolin-3-yl]phenyl]-N-cyclohexylacetamide |
|---|---|
| PubChem CID | 75545038 |
| Molecular Formula | C29H34ClN3O3 |
| Molecular Weight | 508.06 g/mol |
| Exact Mass | 507.23 |
| IUPAC Name | 2-[4-[1-[(2-chlorophenyl)methyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydroquinazolin-3-yl]phenyl]-N-cyclohexylacetamide |
| SMILES | O=C(Cc1ccc(N2C(=O)C3CCCCC3N(Cc3ccccc3Cl)C2=O)cc1)NC1CCCCC1 |
| InChI | InChI=1S/C29H34ClN3O3/c30-25-12-6-4-8-21(25)19-32-26-13-7-5-11-24(26)28(35)33(29(32)36)23-16-14-20(15-17-23)18-27(34)31-22-9-2-1-3-10-22/h4,6,8,12,14-17,22,24,26H,1-3,5,7,9-11,13,18-19H2,(H,31,34) |
| InChIKey | KEFZWQJVSZTDHQ-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.06 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |