C29H34N4O4 — CID 74824642
N-cyclopropyl-2-[4-[1-[2-(2,3-dimethylanilino)-2-oxoethyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydroquinazolin-3-yl]phenyl]acetamide (PubChem CID 74824642) has the molecular formula C29H34N4O4 and a molecular weight of 502.62 g/mol. Its IUPAC name is N-cyclopropyl-2-[4-[1-[2-(2,3-dimethylanilino)-2-oxoethyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydroquinazolin-3-yl]phenyl]acetamide.
| Compound Name | N-cyclopropyl-2-[4-[1-[2-(2,3-dimethylanilino)-2-oxoethyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydroquinazolin-3-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 74824642 |
| Molecular Formula | C29H34N4O4 |
| Molecular Weight | 502.62 g/mol |
| Exact Mass | 502.26 |
| IUPAC Name | N-cyclopropyl-2-[4-[1-[2-(2,3-dimethylanilino)-2-oxoethyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydroquinazolin-3-yl]phenyl]acetamide |
| SMILES | Cc1cccc(NC(=O)CN2C(=O)N(c3ccc(CC(=O)NC4CC4)cc3)C(=O)C3CCCCC32)c1C |
| InChI | InChI=1S/C29H34N4O4/c1-18-6-5-8-24(19(18)2)31-27(35)17-32-25-9-4-3-7-23(25)28(36)33(29(32)37)22-14-10-20(11-15-22)16-26(34)30-21-12-13-21/h5-6,8,10-11,14-15,21,23,25H,3-4,7,9,12-13,16-17H2,1-2H3,(H,30,34)(H,31,35) |
| InChIKey | MZSREDJDWUEQPR-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.62 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |