C13H11F3NO3- — CID 152760268
2-[2-oxo-1-[3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]acetate (PubChem CID 152760268) has the molecular formula C13H11F3NO3- and a molecular weight of 286.23 g/mol. Its IUPAC name is 2-[2-oxo-1-[3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]acetate.
| Compound Name | 2-[2-oxo-1-[3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]acetate |
|---|---|
| PubChem CID | 152760268 |
| Molecular Formula | C13H11F3NO3- |
| Molecular Weight | 286.23 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 2-[2-oxo-1-[3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]acetate |
| SMILES | O=C([O-])CC1CCN(c2cccc(C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C13H12F3NO3/c14-13(15,16)9-2-1-3-10(7-9)17-5-4-8(12(17)20)6-11(18)19/h1-3,7-8H,4-6H2,(H,18,19)/p-1 |
| InChIKey | XGTJYJSWLHCORW-UHFFFAOYSA-M |
| XLogP | 1.20 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.23 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |