C13H14F3NO — CID 175894440
1-ethyl-2-[3-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide (PubChem CID 175894440) has the molecular formula C13H14F3NO and a molecular weight of 257.25 g/mol. Its IUPAC name is 1-ethyl-2-[3-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide.
| Compound Name | 1-ethyl-2-[3-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 175894440 |
| Molecular Formula | C13H14F3NO |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 1-ethyl-2-[3-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide |
| SMILES | CCC1(C(N)=O)CC1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H14F3NO/c1-2-12(11(17)18)7-10(12)8-4-3-5-9(6-8)13(14,15)16/h3-6,10H,2,7H2,1H3,(H2,17,18) |
| InChIKey | JOYGACNHJNOKOQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |