C11H8Cl2F3NO — CID 162607705
trans-(1R,3R)-2,2-dichloro-3-[3-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide (PubChem CID 162607705) has the molecular formula C11H8Cl2F3NO and a molecular weight of 298.09 g/mol. Its IUPAC name is trans-(1R,3R)-2,2-dichloro-3-[3-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide.
| Compound Name | trans-(1R,3R)-2,2-dichloro-3-[3-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 162607705 |
| Molecular Formula | C11H8Cl2F3NO |
| Molecular Weight | 298.09 g/mol |
| Exact Mass | 296.99 |
| IUPAC Name | trans-(1R,3R)-2,2-dichloro-3-[3-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide |
| SMILES | NC(=O)[C@H]1[C@H](c2cccc(C(F)(F)F)c2)C1(Cl)Cl |
| InChI | InChI=1S/C11H8Cl2F3NO/c12-10(13)7(8(10)9(17)18)5-2-1-3-6(4-5)11(14,15)16/h1-4,7-8H,(H2,17,18)/t7-,8+/m0/s1 |
| InChIKey | VRAZWQMKDSSPMX-JGVFFNPUSA-N |
| XLogP | 3.08 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.09 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|