C14H14F3NO3 — CID 175695023
5-hydroxy-3-[3-(trifluoromethyl)phenyl]-7-oxabicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 175695023) has the molecular formula C14H14F3NO3 and a molecular weight of 301.26 g/mol. Its IUPAC name is 5-hydroxy-3-[3-(trifluoromethyl)phenyl]-7-oxabicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | 5-hydroxy-3-[3-(trifluoromethyl)phenyl]-7-oxabicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 175695023 |
| Molecular Formula | C14H14F3NO3 |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 5-hydroxy-3-[3-(trifluoromethyl)phenyl]-7-oxabicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | NC(=O)C1C2CC(O)C(O2)C1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H14F3NO3/c15-14(16,17)7-3-1-2-6(4-7)10-11(13(18)20)9-5-8(19)12(10)21-9/h1-4,8-12,19H,5H2,(H2,18,20) |
| InChIKey | MAHUTKHZURHOQP-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |