C26H27F3O3 — CID 173488943
3-hydroxy-1-[(2S,3S,4S)-3-methyl-6-[3-(trifluoromethyl)phenyl]-7-oxabicyclo[2.2.1]heptan-2-yl]-2-(2,4,6-trimethylphenyl)prop-2-en-1-one (PubChem CID 173488943) has the molecular formula C26H27F3O3 and a molecular weight of 444.49 g/mol. Its IUPAC name is 3-hydroxy-1-[(2S,3S,4S)-3-methyl-6-[3-(trifluoromethyl)phenyl]-7-oxabicyclo[2.2.1]heptan-2-yl]-2-(2,4,6-trimethylphenyl)prop-2-en-1-one.
| Compound Name | 3-hydroxy-1-[(2S,3S,4S)-3-methyl-6-[3-(trifluoromethyl)phenyl]-7-oxabicyclo[2.2.1]heptan-2-yl]-2-(2,4,6-trimethylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 173488943 |
| Molecular Formula | C26H27F3O3 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | 3-hydroxy-1-[(2S,3S,4S)-3-methyl-6-[3-(trifluoromethyl)phenyl]-7-oxabicyclo[2.2.1]heptan-2-yl]-2-(2,4,6-trimethylphenyl)prop-2-en-1-one |
| SMILES | Cc1cc(C)c(C(=CO)C(=O)[C@@H]2C3O[C@@H](CC3c3cccc(C(F)(F)F)c3)[C@H]2C)c(C)c1 |
| InChI | InChI=1S/C26H27F3O3/c1-13-8-14(2)22(15(3)9-13)20(12-30)24(31)23-16(4)21-11-19(25(23)32-21)17-6-5-7-18(10-17)26(27,28)29/h5-10,12,16,19,21,23,25,30H,11H2,1-4H3/t16-,19?,21+,23-,25?/m1/s1 |
| InChIKey | LPNNKIBADJIPPC-YXNQBKTCSA-N |
| XLogP | 6.31 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|