C16H17F3N2O2 — CID 135346548
1-cyclopropyl-2-oxo-4-[3-(trifluoromethyl)phenyl]piperidine-3-carboxamide (PubChem CID 135346548) has the molecular formula C16H17F3N2O2 and a molecular weight of 326.32 g/mol. Its IUPAC name is 1-cyclopropyl-2-oxo-4-[3-(trifluoromethyl)phenyl]piperidine-3-carboxamide.
| Compound Name | 1-cyclopropyl-2-oxo-4-[3-(trifluoromethyl)phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 135346548 |
| Molecular Formula | C16H17F3N2O2 |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 1-cyclopropyl-2-oxo-4-[3-(trifluoromethyl)phenyl]piperidine-3-carboxamide |
| SMILES | NC(=O)C1C(=O)N(C2CC2)CCC1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H17F3N2O2/c17-16(18,19)10-3-1-2-9(8-10)12-6-7-21(11-4-5-11)15(23)13(12)14(20)22/h1-3,8,11-13H,4-7H2,(H2,20,22) |
| InChIKey | GFFMYYVARFDYOD-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|