C15H24O4 — CID 13436243
3,8-dibutyl-2,7-dioxaspiro[4.4]nonane-1,6-dione (PubChem CID 13436243) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is 3,8-dibutyl-2,7-dioxaspiro[4.4]nonane-1,6-dione.
| Compound Name | 3,8-dibutyl-2,7-dioxaspiro[4.4]nonane-1,6-dione |
|---|---|
| PubChem CID | 13436243 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 3,8-dibutyl-2,7-dioxaspiro[4.4]nonane-1,6-dione |
| SMILES | CCCCC1CC2(CC(CCCC)OC2=O)C(=O)O1 |
| InChI | InChI=1S/C15H24O4/c1-3-5-7-11-9-15(13(16)18-11)10-12(8-6-4-2)19-14(15)17/h11-12H,3-10H2,1-2H3 |
| InChIKey | PCXQHAZJWPLGCH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|