C10H17IO2 — CID 71417873
3,3-diethyl-5-(2-iodoethyl)oxolan-2-one (PubChem CID 71417873) has the molecular formula C10H17IO2 and a molecular weight of 296.15 g/mol. Its IUPAC name is 3,3-diethyl-5-(2-iodoethyl)oxolan-2-one.
| Compound Name | 3,3-diethyl-5-(2-iodoethyl)oxolan-2-one |
|---|---|
| PubChem CID | 71417873 |
| Molecular Formula | C10H17IO2 |
| Molecular Weight | 296.15 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | 3,3-diethyl-5-(2-iodoethyl)oxolan-2-one |
| SMILES | CCC1(CC)CC(CCI)OC1=O |
| InChI | InChI=1S/C10H17IO2/c1-3-10(4-2)7-8(5-6-11)13-9(10)12/h8H,3-7H2,1-2H3 |
| InChIKey | NKVPWOUYETVUFI-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.15 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|