C8H15NO2 — CID 45082203
(3S,5S)-3-amino-5-butyloxolan-2-one (PubChem CID 45082203) has the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. Its IUPAC name is (3S,5S)-3-amino-5-butyloxolan-2-one.
| Compound Name | (3S,5S)-3-amino-5-butyloxolan-2-one |
|---|---|
| PubChem CID | 45082203 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | (3S,5S)-3-amino-5-butyloxolan-2-one |
| SMILES | CCCC[C@H]1C[C@H](N)C(=O)O1 |
| InChI | InChI=1S/C8H15NO2/c1-2-3-4-6-5-7(9)8(10)11-6/h6-7H,2-5,9H2,1H3/t6-,7-/m0/s1 |
| InChIKey | OLYWNFJDCDKNSI-BQBZGAKWSA-N |
| XLogP | 0.82 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |