C14H18O3 — CID 139603112
(3R,5S)-5-butyl-3-(4-hydroxyphenyl)oxolan-2-one (PubChem CID 139603112) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is (3R,5S)-5-butyl-3-(4-hydroxyphenyl)oxolan-2-one.
| Compound Name | (3R,5S)-5-butyl-3-(4-hydroxyphenyl)oxolan-2-one |
|---|---|
| PubChem CID | 139603112 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | (3R,5S)-5-butyl-3-(4-hydroxyphenyl)oxolan-2-one |
| SMILES | CCCC[C@H]1C[C@H](c2ccc(O)cc2)C(=O)O1 |
| InChI | InChI=1S/C14H18O3/c1-2-3-4-12-9-13(14(16)17-12)10-5-7-11(15)8-6-10/h5-8,12-13,15H,2-4,9H2,1H3/t12-,13+/m0/s1 |
| InChIKey | YTMCZFSRKLQYNR-QWHCGFSZSA-N |
| XLogP | 2.98 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |