C31H42O5 — CID 15653395
[4-[(3S,5R)-5-hexyl-2-oxooxolan-3-yl]phenyl] 4-octoxybenzoate (PubChem CID 15653395) has the molecular formula C31H42O5 and a molecular weight of 494.67 g/mol. Its IUPAC name is [4-[(3S,5R)-5-hexyl-2-oxooxolan-3-yl]phenyl] 4-octoxybenzoate.
| Compound Name | [4-[(3S,5R)-5-hexyl-2-oxooxolan-3-yl]phenyl] 4-octoxybenzoate |
|---|---|
| PubChem CID | 15653395 |
| Molecular Formula | C31H42O5 |
| Molecular Weight | 494.67 g/mol |
| Exact Mass | 494.30 |
| IUPAC Name | [4-[(3S,5R)-5-hexyl-2-oxooxolan-3-yl]phenyl] 4-octoxybenzoate |
| SMILES | CCCCCCCCOc1ccc(C(=O)Oc2ccc([C@@H]3C[C@@H](CCCCCC)OC3=O)cc2)cc1 |
| InChI | InChI=1S/C31H42O5/c1-3-5-7-9-10-12-22-34-26-18-16-25(17-19-26)30(32)35-27-20-14-24(15-21-27)29-23-28(36-31(29)33)13-11-8-6-4-2/h14-21,28-29H,3-13,22-23H2,1-2H3/t28-,29+/m1/s1 |
| InChIKey | YCIMTUQFGWXCHR-WDYNHAJCSA-N |
| XLogP | 8.01 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.67 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|