C26H27N5O3 — CID 110063452
(6R,11S,13E)-9-[3-(1,2,4-triazol-4-yl)benzoyl]-2-oxa-5,9-diazatricyclo[14.4.0.06,11]icosa-1(20),13,16,18-tetraen-4-one (PubChem CID 110063452) has the molecular formula C26H27N5O3 and a molecular weight of 457.53 g/mol. Its IUPAC name is (6R,11S,13E)-9-[3-(1,2,4-triazol-4-yl)benzoyl]-2-oxa-5,9-diazatricyclo[14.4.0.06,11]icosa-1(20),13,16,18-tetraen-4-one.
| Compound Name | (6R,11S,13E)-9-[3-(1,2,4-triazol-4-yl)benzoyl]-2-oxa-5,9-diazatricyclo[14.4.0.06,11]icosa-1(20),13,16,18-tetraen-4-one |
|---|---|
| PubChem CID | 110063452 |
| Molecular Formula | C26H27N5O3 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | (6R,11S,13E)-9-[3-(1,2,4-triazol-4-yl)benzoyl]-2-oxa-5,9-diazatricyclo[14.4.0.06,11]icosa-1(20),13,16,18-tetraen-4-one |
| SMILES | O=C1COc2ccccc2C/C=C/C[C@H]2CN(C(=O)c3cccc(-n4cnnc4)c3)CC[C@H]2N1 |
| InChI | InChI=1S/C26H27N5O3/c32-25-16-34-24-11-4-3-7-19(24)6-1-2-8-21-15-30(13-12-23(21)29-25)26(33)20-9-5-10-22(14-20)31-17-27-28-18-31/h1-5,7,9-11,14,17-18,21,23H,6,8,12-13,15-16H2,(H,29,32)/b2-1+/t21-,23+/m0/s1 |
| InChIKey | UTEWJCWUQPFNJM-WKSVDYBKSA-N |
| XLogP | 2.80 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|