C24H27N3O4 — CID 133072558
(1S,13E,16S)-17-(2-methoxypyridine-3-carbonyl)-10-oxa-2,17-diazatricyclo[14.4.0.04,9]icosa-4,6,8,13-tetraen-3-one (PubChem CID 133072558) has the molecular formula C24H27N3O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is (1S,13E,16S)-17-(2-methoxypyridine-3-carbonyl)-10-oxa-2,17-diazatricyclo[14.4.0.04,9]icosa-4,6,8,13-tetraen-3-one.
| Compound Name | (1S,13E,16S)-17-(2-methoxypyridine-3-carbonyl)-10-oxa-2,17-diazatricyclo[14.4.0.04,9]icosa-4,6,8,13-tetraen-3-one |
|---|---|
| PubChem CID | 133072558 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | (1S,13E,16S)-17-(2-methoxypyridine-3-carbonyl)-10-oxa-2,17-diazatricyclo[14.4.0.04,9]icosa-4,6,8,13-tetraen-3-one |
| SMILES | COc1ncccc1C(=O)N1CCC[C@@H]2NC(=O)c3ccccc3OCC/C=C/C[C@@H]21 |
| InChI | InChI=1S/C24H27N3O4/c1-30-23-18(10-7-14-25-23)24(29)27-15-8-11-19-20(27)12-3-2-6-16-31-21-13-5-4-9-17(21)22(28)26-19/h2-5,7,9-10,13-14,19-20H,6,8,11-12,15-16H2,1H3,(H,26,28)/b3-2+/t19-,20-/m0/s1 |
| InChIKey | HVTJRWXWAVZLBK-ILZVPNCDSA-N |
| XLogP | 3.22 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|