C23H26N4O4 — CID 133072577
(1S,13E,16S)-17-[2-(2-oxopyrimidin-1-yl)acetyl]-10-oxa-2,17-diazatricyclo[14.4.0.04,9]icosa-4,6,8,13-tetraen-3-one (PubChem CID 133072577) has the molecular formula C23H26N4O4 and a molecular weight of 422.49 g/mol. Its IUPAC name is (1S,13E,16S)-17-[2-(2-oxopyrimidin-1-yl)acetyl]-10-oxa-2,17-diazatricyclo[14.4.0.04,9]icosa-4,6,8,13-tetraen-3-one.
| Compound Name | (1S,13E,16S)-17-[2-(2-oxopyrimidin-1-yl)acetyl]-10-oxa-2,17-diazatricyclo[14.4.0.04,9]icosa-4,6,8,13-tetraen-3-one |
|---|---|
| PubChem CID | 133072577 |
| Molecular Formula | C23H26N4O4 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | (1S,13E,16S)-17-[2-(2-oxopyrimidin-1-yl)acetyl]-10-oxa-2,17-diazatricyclo[14.4.0.04,9]icosa-4,6,8,13-tetraen-3-one |
| SMILES | O=C1N[C@H]2CCCN(C(=O)Cn3cccnc3=O)[C@H]2C/C=C/CCOc2ccccc21 |
| InChI | InChI=1S/C23H26N4O4/c28-21(16-26-13-7-12-24-23(26)30)27-14-6-9-18-19(27)10-2-1-5-15-31-20-11-4-3-8-17(20)22(29)25-18/h1-4,7-8,11-13,18-19H,5-6,9-10,14-16H2,(H,25,29)/b2-1+/t18-,19-/m0/s1 |
| InChIKey | PTUXJQPGEDGJHN-WNJMFGOSSA-N |
| XLogP | 1.76 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|