C26H30N6O5 — CID 110074653
1,3-dimethyl-7-[2-oxo-2-[(6R,11R,13E)-4-oxo-2-oxa-5,10-diazatricyclo[14.4.0.06,11]icosa-1(20),13,16,18-tetraen-10-yl]ethyl]purine-2,6-dione (PubChem CID 110074653) has the molecular formula C26H30N6O5 and a molecular weight of 506.56 g/mol. Its IUPAC name is 1,3-dimethyl-7-[2-oxo-2-[(6R,11R,13E)-4-oxo-2-oxa-5,10-diazatricyclo[14.4.0.06,11]icosa-1(20),13,16,18-tetraen-10-yl]ethyl]purine-2,6-dione.
| Compound Name | 1,3-dimethyl-7-[2-oxo-2-[(6R,11R,13E)-4-oxo-2-oxa-5,10-diazatricyclo[14.4.0.06,11]icosa-1(20),13,16,18-tetraen-10-yl]ethyl]purine-2,6-dione |
|---|---|
| PubChem CID | 110074653 |
| Molecular Formula | C26H30N6O5 |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | 1,3-dimethyl-7-[2-oxo-2-[(6R,11R,13E)-4-oxo-2-oxa-5,10-diazatricyclo[14.4.0.06,11]icosa-1(20),13,16,18-tetraen-10-yl]ethyl]purine-2,6-dione |
| SMILES | Cn1c(=O)c2c(ncn2CC(=O)N2CCC[C@H]3NC(=O)COc4ccccc4C/C=C/C[C@H]32)n(C)c1=O |
| InChI | InChI=1S/C26H30N6O5/c1-29-24-23(25(35)30(2)26(29)36)31(16-27-24)14-22(34)32-13-7-10-18-19(32)11-5-3-8-17-9-4-6-12-20(17)37-15-21(33)28-18/h3-6,9,12,16,18-19H,7-8,10-11,13-15H2,1-2H3,(H,28,33)/b5-3+/t18-,19-/m1/s1 |
| InChIKey | XSNFYRUCKJJCLK-BWTKPXILSA-N |
| XLogP | 0.49 |
| TPSA | 120.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|