C22H30N2O7 — CID 155409204
ethyl 3-[[2-hydroxy-2-[(8Z,11S)-13-oxo-3,6-dioxa-12-azabicyclo[12.4.0]octadeca-1(18),8,14,16-tetraen-11-yl]acetyl]amino]propanoate (PubChem CID 155409204) has the molecular formula C22H30N2O7 and a molecular weight of 434.49 g/mol. Its IUPAC name is ethyl 3-[[2-hydroxy-2-[(8Z,11S)-13-oxo-3,6-dioxa-12-azabicyclo[12.4.0]octadeca-1(18),8,14,16-tetraen-11-yl]acetyl]amino]propanoate.
| Compound Name | ethyl 3-[[2-hydroxy-2-[(8Z,11S)-13-oxo-3,6-dioxa-12-azabicyclo[12.4.0]octadeca-1(18),8,14,16-tetraen-11-yl]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 155409204 |
| Molecular Formula | C22H30N2O7 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | ethyl 3-[[2-hydroxy-2-[(8Z,11S)-13-oxo-3,6-dioxa-12-azabicyclo[12.4.0]octadeca-1(18),8,14,16-tetraen-11-yl]acetyl]amino]propanoate |
| SMILES | CCOC(=O)CCNC(=O)C(O)[C@@H]1C/C=C\COCCOCc2ccccc2C(=O)N1 |
| InChI | InChI=1S/C22H30N2O7/c1-2-31-19(25)10-11-23-22(28)20(26)18-9-5-6-12-29-13-14-30-15-16-7-3-4-8-17(16)21(27)24-18/h3-8,18,20,26H,2,9-15H2,1H3,(H,23,28)(H,24,27)/b6-5-/t18-,20?/m0/s1 |
| InChIKey | AVOHCCCLQJJTJE-MWJRXIJFSA-N |
| XLogP | 0.71 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|