C17H19NO — CID 97102714
(4S)-4-benzyl-3,4,5,6-tetrahydro-1H-2,5-benzoxazocine (PubChem CID 97102714) has the molecular formula C17H19NO and a molecular weight of 253.35 g/mol. Its IUPAC name is (4S)-4-benzyl-3,4,5,6-tetrahydro-1H-2,5-benzoxazocine.
| Compound Name | (4S)-4-benzyl-3,4,5,6-tetrahydro-1H-2,5-benzoxazocine |
|---|---|
| PubChem CID | 97102714 |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | (4S)-4-benzyl-3,4,5,6-tetrahydro-1H-2,5-benzoxazocine |
| SMILES | c1ccc(C[C@H]2COCc3ccccc3CN2)cc1 |
| InChI | InChI=1S/C17H19NO/c1-2-6-14(7-3-1)10-17-13-19-12-16-9-5-4-8-15(16)11-18-17/h1-9,17-18H,10-13H2/t17-/m0/s1 |
| InChIKey | FIDDBFSBYXUIQD-KRWDZBQOSA-N |
| XLogP | 2.92 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |