C19H21N — CID 79970904
3-benzyl-5-cyclopropyl-1,2,3,4-tetrahydroisoquinoline (PubChem CID 79970904) has the molecular formula C19H21N and a molecular weight of 263.38 g/mol. Its IUPAC name is 3-benzyl-5-cyclopropyl-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 3-benzyl-5-cyclopropyl-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 79970904 |
| Molecular Formula | C19H21N |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 3-benzyl-5-cyclopropyl-1,2,3,4-tetrahydroisoquinoline |
| SMILES | c1ccc(CC2Cc3c(cccc3C3CC3)CN2)cc1 |
| InChI | InChI=1S/C19H21N/c1-2-5-14(6-3-1)11-17-12-19-16(13-20-17)7-4-8-18(19)15-9-10-15/h1-8,15,17,20H,9-13H2 |
| InChIKey | DUJGDWZIXARRRE-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |