C20H20N2 — CID 18422490
3-benzyl-2,3,4,5-tetrahydro-1H-benzo[h][1,4]benzodiazepine (PubChem CID 18422490) has the molecular formula C20H20N2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 3-benzyl-2,3,4,5-tetrahydro-1H-benzo[h][1,4]benzodiazepine.
| Compound Name | 3-benzyl-2,3,4,5-tetrahydro-1H-benzo[h][1,4]benzodiazepine |
|---|---|
| PubChem CID | 18422490 |
| Molecular Formula | C20H20N2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 3-benzyl-2,3,4,5-tetrahydro-1H-benzo[h][1,4]benzodiazepine |
| SMILES | c1ccc(CC2CNc3cc4ccccc4cc3CN2)cc1 |
| InChI | InChI=1S/C20H20N2/c1-2-6-15(7-3-1)10-19-14-22-20-12-17-9-5-4-8-16(17)11-18(20)13-21-19/h1-9,11-12,19,21-22H,10,13-14H2 |
| InChIKey | ZCXFQDMTVDFSCY-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |