C20H24N2 — CID 67709513
(3S)-3-[2-(1,2,3,4-tetrahydroisoquinolin-3-yl)ethyl]-1,2,3,4-tetrahydroisoquinoline (PubChem CID 67709513) has the molecular formula C20H24N2 and a molecular weight of 292.43 g/mol. Its IUPAC name is (3S)-3-[2-(1,2,3,4-tetrahydroisoquinolin-3-yl)ethyl]-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | (3S)-3-[2-(1,2,3,4-tetrahydroisoquinolin-3-yl)ethyl]-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 67709513 |
| Molecular Formula | C20H24N2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | (3S)-3-[2-(1,2,3,4-tetrahydroisoquinolin-3-yl)ethyl]-1,2,3,4-tetrahydroisoquinoline |
| SMILES | c1ccc2c(c1)CNC(CC[C@H]1Cc3ccccc3CN1)C2 |
| InChI | InChI=1S/C20H24N2/c1-3-7-17-13-21-19(11-15(17)5-1)9-10-20-12-16-6-2-4-8-18(16)14-22-20/h1-8,19-22H,9-14H2/t19-,20?/m0/s1 |
| InChIKey | RLWGNDOSCLHCOV-XJDOXCRVSA-N |
| XLogP | 3.20 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |