C10H12BrN — CID 71381550
3-(bromomethyl)-1,2,3,4-tetrahydroisoquinoline (PubChem CID 71381550) has the molecular formula C10H12BrN and a molecular weight of 226.12 g/mol. Its IUPAC name is 3-(bromomethyl)-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 3-(bromomethyl)-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 71381550 |
| Molecular Formula | C10H12BrN |
| Molecular Weight | 226.12 g/mol |
| Exact Mass | 225.02 |
| IUPAC Name | 3-(bromomethyl)-1,2,3,4-tetrahydroisoquinoline |
| SMILES | BrCC1Cc2ccccc2CN1 |
| InChI | InChI=1S/C10H12BrN/c11-6-10-5-8-3-1-2-4-9(8)7-12-10/h1-4,10,12H,5-7H2 |
| InChIKey | JHUMBCOHJAZMJK-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.12 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|