C10H12ClNO4S — CID 171184265
(4R)-4-(4-methylsulfonylphenyl)-1,3-oxazolidin-2-one;hydrochloride (PubChem CID 171184265) has the molecular formula C10H12ClNO4S and a molecular weight of 277.73 g/mol. Its IUPAC name is (4R)-4-(4-methylsulfonylphenyl)-1,3-oxazolidin-2-one;hydrochloride.
| Compound Name | (4R)-4-(4-methylsulfonylphenyl)-1,3-oxazolidin-2-one;hydrochloride |
|---|---|
| PubChem CID | 171184265 |
| Molecular Formula | C10H12ClNO4S |
| Molecular Weight | 277.73 g/mol |
| Exact Mass | 277.02 |
| IUPAC Name | (4R)-4-(4-methylsulfonylphenyl)-1,3-oxazolidin-2-one;hydrochloride |
| SMILES | CS(=O)(=O)c1ccc([C@@H]2COC(=O)N2)cc1.Cl |
| InChI | InChI=1S/C10H11NO4S.ClH/c1-16(13,14)8-4-2-7(3-5-8)9-6-15-10(12)11-9;/h2-5,9H,6H2,1H3,(H,11,12);1H/t9-;/m0./s1 |
| InChIKey | ZOBLZZFVKBUTSX-FVGYRXGTSA-N |
| XLogP | 1.29 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.73 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |