C11H3Cl3F3N — CID 133090436
3-chloro-4-(3,5-dichlorophenyl)-2,5,6-trifluoropyridine (PubChem CID 133090436) has the molecular formula C11H3Cl3F3N and a molecular weight of 312.51 g/mol. Its IUPAC name is 3-chloro-4-(3,5-dichlorophenyl)-2,5,6-trifluoropyridine.
| Compound Name | 3-chloro-4-(3,5-dichlorophenyl)-2,5,6-trifluoropyridine |
|---|---|
| PubChem CID | 133090436 |
| Molecular Formula | C11H3Cl3F3N |
| Molecular Weight | 312.51 g/mol |
| Exact Mass | 310.93 |
| IUPAC Name | 3-chloro-4-(3,5-dichlorophenyl)-2,5,6-trifluoropyridine |
| SMILES | Fc1nc(F)c(Cl)c(-c2cc(Cl)cc(Cl)c2)c1F |
| InChI | InChI=1S/C11H3Cl3F3N/c12-5-1-4(2-6(13)3-5)7-8(14)10(16)18-11(17)9(7)15/h1-3H |
| InChIKey | FHKCYNOACQNGKK-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.51 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|