C11H4F5N — CID 46313129
2,3,5,6-tetrafluoro-4-(4-fluorophenyl)pyridine (PubChem CID 46313129) has the molecular formula C11H4F5N and a molecular weight of 245.15 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-(4-fluorophenyl)pyridine.
| Compound Name | 2,3,5,6-tetrafluoro-4-(4-fluorophenyl)pyridine |
|---|---|
| PubChem CID | 46313129 |
| Molecular Formula | C11H4F5N |
| Molecular Weight | 245.15 g/mol |
| Exact Mass | 245.03 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-(4-fluorophenyl)pyridine |
| SMILES | Fc1ccc(-c2c(F)c(F)nc(F)c2F)cc1 |
| InChI | InChI=1S/C11H4F5N/c12-6-3-1-5(2-4-6)7-8(13)10(15)17-11(16)9(7)14/h1-4H |
| InChIKey | HKHXSLORJCIQGQ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.15 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|